Content deleted Content added
No edit summary |
m Open access bot: hdl updated in citation with #oabot. |
||
(16 intermediate revisions by 11 users not shown) | |||
Line 1:
{{Short description|Chemical compound}}
<!--
{{Hatnote|MTEP also stands for [[Magnetothermoelectric Power]], for the [[Medium Term Economic Program]], for the [[Medium-Term Employment Plan]], for the OECD's [[Medium-Term Expenditure Programme]], for the [[MISO Transmission Expansion Plan|MISO (Midwest Independent System Operator) Transmission Expansion Plan]], for the [[Multinational Test and Evaluation Program]], and for the [[Myanmar Total Exploration and Production]] Company}}
-->
{{Drugbox
| Verifiedfields = changed
Line 29 ⟶ 33:
<!--Chemical data-->
| C=11 | H=8 | N=2 | S=1
| smiles = CC1=NC(=CS1)C#CC2=CN=CC=C2
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
Line 37 ⟶ 40:
}}
'''3-((2-Methyl-4-thiazolyl)ethynyl)pyridine''' ('''MTEP''') is a research drug that was developed by [[Merck & Co.]] as a selective [[allosteric]] [[Antagonist (pharmacology)|antagonist]] of the [[metabotropic glutamate receptor]] subtype [[Metabotropic glutamate receptor 5|mGluR5]]. Identified through [[structure-activity relationship]] studies on an older mGluR5 antagonist [[2-Methyl-6-(phenylethynyl)pyridine|MPEP]],<ref>{{cite journal
▲}}</ref><ref>{{Cite journal | last1 = Szydlowska | first1 = K. | last2 = Kaminska | first2 = B. | last3 = Baude | first3 = A. | last4 = Parsons | first4 = C. G. | last5 = Danysz | first5 = W. | title = Neuroprotective activity of selective mGlu1 and mGlu5 antagonists in vitro and in vivo | doi = 10.1016/j.ejphar.2006.09.061 | journal = European Journal of Pharmacology | volume = 554 | issue = 1 | pages = 18–29 | year = 2007 | pmid = 17109843| pmc = }}</ref> [[antidepressant]],<ref>{{Cite journal | last1 = Pałucha | first1 = A. | last2 = Brański | first2 = P. | last3 = Szewczyk | first3 = B. | last4 = Wierońska | first4 = J. M. | last5 = Kłak | first5 = K. | last6 = Pilc | first6 = A. | doi = 10.1016/j.pbb.2005.06.015 | title = Potential antidepressant-like effect of MTEP, a potent and highly selective mGluR5 antagonist | journal = Pharmacology Biochemistry and Behavior | volume = 81 | issue = 4 | pages = 901 | year = 2005 | pmid = | pmc = }}</ref><ref>{{Cite journal | last1 = Molina-Hernández | first1 = M. | last2 = Tellez-Alcántara | first2 = N. P. | last3 = Pérez-García | first3 = J. N. | last4 = Olivera-Lopez | first4 = J. I. N. | last5 = Jaramillo | first5 = M. T. | title = Antidepressant-like and anxiolytic-like actions of the mGlu5 receptor antagonist MTEP, microinjected into lateral septal nuclei of male Wistar rats | doi = 10.1016/j.pnpbp.2006.04.022 | journal = Progress in Neuro-Psychopharmacology and Biological Psychiatry | volume = 30 | issue = 6 | pages = 1129–1135 | year = 2006 | pmid = 16759778| pmc = }}</ref><ref>{{Cite journal | last1 = Li | first1 = X. | last2 = Need | first2 = A. B. | last3 = Baez | first3 = M. | last4 = Witkin | first4 = J. M. | title = Metabotropic Glutamate 5 Receptor Antagonism is Associated with Antidepressant-Like Effects in Mice | doi = 10.1124/jpet.106.103143 | journal = Journal of Pharmacology and Experimental Therapeutics | volume = 319 | issue = 1 | pages = 254–259 | year = 2006 | pmid = 16803860| pmc = }}</ref><ref>{{Cite journal | last1 = Belozertseva | first1 = I. | last2 = Kos | first2 = T. | last3 = Popik | first3 = P. | last4 = Danysz | first4 = W. | last5 = Bespalov | first5 = A. | title = Antidepressant-like effects of mGluR1 and mGluR5 antagonists in the rat forced swim and the mouse tail suspension tests | doi = 10.1016/j.euroneuro.2006.03.002 | journal = European Neuropsychopharmacology | volume = 17 | issue = 3 | pages = 172–179 | year = 2007 | pmid = 16630709| pmc = }}</ref> [[analgesic]],<ref>{{Cite journal | last1 = Zhu | first1 = C. Z. | last2 = Wilson | first2 = S. G. | last3 = Mikusa | first3 = J. P. | last4 = Wismer | first4 = C. T. | last5 = Gauvin | first5 = D. M. | last6 = Lynch Jj | first6 = J. J. | last7 = Wade | first7 = C. L. | last8 = Decker | first8 = M. W. | last9 = Honore | first9 = P. | doi = 10.1016/j.ejphar.2004.11.005 | title = Assessing the role of metabotropic glutamate receptor 5 in multiple nociceptive modalities | journal = European Journal of Pharmacology | volume = 506 | issue = 2 | pages = 107–118 | year = 2004 | pmid = 15588730| pmc = }}</ref><ref>{{Cite journal | last1 = Varty | first1 = G. B. | last2 = Grilli | first2 = M. | last3 = Forlani | first3 = A. | last4 = Fredduzzi | first4 = S. | last5 = Grzelak | first5 = M. E. | last6 = Guthrie | first6 = D. H. | last7 = Hodgson | first7 = R. A. | last8 = Lu | first8 = S. X. | last9 = Nicolussi | first9 = E. | doi = 10.1007/s00213-005-2143-4 | last10 = Pond | first10 = A. J. | last11 = Parker | first11 = E. M. | last12 = Hunter | first12 = J. C. | last13 = Higgins | first13 = G. A. | last14 = Reggiani | first14 = A. | last15 = Bertorelli | first15 = R. | title = The antinociceptive and anxiolytic-like effects of the metabotropic glutamate receptor 5 (mGluR5) antagonists, MPEP and MTEP, and the mGluR1 antagonist, LY456236, in rodents: A comparison of efficacy and side-effect profiles | journal = Psychopharmacology | volume = 179 | issue = 1 | pages = 207–217 | year = 2005 | pmid = 15682298| pmc = }}</ref> and [[anxiolytic]] effects but with either similar or higher [[efficacy]] depending on the test used.<ref>{{Cite journal | last1 = Klodzinska | first1 = A. | last2 = Tatarczyńska | first2 = E. | last3 = Chojnacka-Wójcik | first3 = E. | last4 = Nowak | first4 = G. | last5 = Cosford | first5 = N. D. P. | last6 = Pilc | first6 = A. | doi = 10.1016/j.neuropharm.2004.04.013 | title = Anxiolytic-like effects of MTEP, a potent and selective mGlu5 receptor agonist does not involve GABAA signaling | journal = Neuropharmacology | volume = 47 | issue = 3 | pages = 342–350 | year = 2004 | pmid = 15275823| pmc = }}</ref><ref>{{Cite journal | last1 = Busse | first1 = C. S. | last2 = Brodkin | first2 = J. | last3 = Tattersall | first3 = D. | last4 = Anderson | first4 = J. J. | last5 = Warren | first5 = N. | last6 = Tehrani | first6 = L. | last7 = Bristow | first7 = L. J. | last8 = Varney | first8 = M. A. | last9 = Cosford | first9 = N. D. | doi = 10.1038/sj.npp.1300540 | title = The Behavioral Profile of the Potent and Selective mGlu5 Receptor Antagonist 3-\(2-methyl-1,3-thiazol-4-yl)ethynyl]pyridine (MTEP) in Rodent Models of Anxiety | journal = Neuropsychopharmacology | volume = 29 | issue = 11 | pages = 1971–1979 | year = 2004 | pmid = 15305166| pmc = }}</ref><ref>{{Cite journal | last1 = Pietraszek | first1 = M. G. | last2 = Sukhanov | first2 = I. | last3 = MacIejak | first3 = P. | last4 = Szyndler | first4 = J. | last5 = Gravius | first5 = A. | last6 = Wisłowska | first6 = A. | last7 = Płaźnik | first7 = A. | last8 = Bespalov | first8 = A. Y. | last9 = Danysz | first9 = W. | doi = 10.1016/j.ejphar.2005.03.028 | title = Anxiolytic-like effects of mGlu1 and mGlu5 receptor antagonists in rats | journal = European Journal of Pharmacology | volume = 514 | issue = 1 | pages = 25–34 | year = 2005 | pmid = 15878321| pmc = }}</ref><ref>{{Cite journal | last1 = Stachowicz | first1 = K. | last2 = Gołembiowska | first2 = K. | last3 = Sowa | first3 = M. | last4 = Nowak | first4 = G. | last5 = Chojnacka-Wójcik | first5 = E. | last6 = Pilc | first6 = A. | doi = 10.1016/j.neuropharm.2007.08.002 | title = Anxiolytic-like action of MTEP expressed in the conflict drinking Vogel test in rats is serotonin dependent | journal = Neuropharmacology | volume = 53 | issue = 6 | pages = 741–748 | year = 2007 | pmid = 17870136| pmc = }}</ref>
MTEP also has similar efficacy to MPEP in reducing the symptoms of [[morphine]] [[Drug withdrawal|withdrawal]],<ref>{{cite journal | vauthors = Pałucha A, Brański P, Pilc A | title = Selective mGlu5 receptor antagonist MTEP attenuates naloxone-induced morphine
== See also ==
*[[2-Methyl-6-(phenylethynyl)pyridine|MPEP]]
*[[MFZ 10-7]]
*[[Fenobam]]
== References ==
{{Reflist|30em}}
Line 65 ⟶ 57:
[[Category:Thiazoles]]
[[Category:
[[Category:
[[Category:MGlu5 receptor antagonists]]
|