MTEP: Difference between revisions

Content deleted Content added
Dexbot (talk | contribs)
m Bot: Deprecating Template:Cite doi and some minor fixes
OAbot (talk | contribs)
m Open access bot: hdl updated in citation with #oabot.
 
(26 intermediate revisions by 17 users not shown)
Line 1:
{{Short description|Chemical compound}}
<!--
{{Hatnote|MTEP also stands for [[Magnetothermoelectric Power]], for the [[Medium Term Economic Program]], for the [[Medium-Term Employment Plan]], for the OECD's [[Medium-Term Expenditure Programme]], for the [[MISO Transmission Expansion Plan|MISO (Midwest Independent System Operator) Transmission Expansion Plan]], for the [[Multinational Test and Evaluation Program]], and for the [[Myanmar Total Exploration and Production]] Company}}
-->
{{Drugbox
| Verifiedfields = changed
Line 29 ⟶ 33:
<!--Chemical data-->
| C=11 | H=8 | N=2 | S=1
| molecular_weight = 200.260 g/mol
| smiles = CC1=NC(=CS1)C#CC2=CN=CC=C2
| InChI = 1/C11H8N2S/c1-9-13-11(8-14-9)5-4-10-3-2-6-12-7-10/h2-3,6-8H,1H3
| InChIKey = NRBNGHCYDWUVLC-UHFFFAOYAD
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C11H8N2S/c1-9-13-11(8-14-9)5-4-10-3-2-6-12-7-10/h2-3,6-8H,1H3
Line 39 ⟶ 40:
}}
 
'''3-((2-Methyl-4-thiazolyl)ethynyl)pyridine''' ('''MTEP''') is a research drug that was developed by [[Merck & Co.]] as a selective [[allosteric]] [[Antagonist (pharmacology)|antagonist]] of the [[metabotropic glutamate receptor]] subtype [[Metabotropic glutamate receptor 5|mGluR5]]. Identified through [[structure-activity relationship]] studies on an older mGluR5 antagonist [[2-Methyl-6-(phenylethynyl)pyridine|MPEP]],<ref>{{cite journal | vauthors = Cosford ND, Tehrani L, Roppe J, etalSchweiger E, Smith ND, Anderson J, Bristow L, Brodkin J, Jiang X, McDonald I, Rao S, Washburn M, Varney MA | display-authors = 6 | title = 3-[(2-Methyl-1,3-thiazol-4-yl)ethynyl]-pyridine: a potent and highly selective metabotropic glutamate subtype 5 receptor antagonist with anxiolytic activity | journal =J. Med.Journal Chem.of Medicinal Chemistry | volume = 46 | issue = 2 | pages =204–6 204–206 | date = January 2003 | pmid = 12519057 | doi = 10.1021/jm025570j |url=}}</ref> MTEP has subsequently itself acted as a [[lead compound]] for newer and even more improved drugs.<ref>{{cite journal | vauthors = Iso Y, Grajkowska E, Wroblewski JT, etalDavis J, Goeders NE, Johnson KM, Sanker S, Roth BL, Tueckmantel W, Kozikowski AP | display-authors = 6 | title = Synthesis and structure-activity relationships of 3-[(2-methyl-1,3-thiazol-4-yl)ethynyl]pyridine analogues as potent, noncompetitive metabotropic glutamate receptor subtype 5 antagonists; search for cocaine medications | journal =J. Med.Journal Chem.of Medicinal Chemistry | volume = 49 | issue = 3 | pages =1080–100 1080–1100 | date = February 2006 | pmid = 16451073 | doi = 10.1021/jm050570f |url=}}</ref><ref>{{cite journal |author vauthors = Kulkarni SS, Newman AH | title = Discovery of heterobicyclic templates for novel metabotropic glutamate receptor subtype 5 antagonists | journal =Bioorg. Med.Bioorganic Chem.& Lett.Medicinal Chemistry Letters | volume = 17 | issue = 11 | pages =2987–91 2987–2991 | date = June 2007 | pmid = 17446071 | pmc = 1973162 | doi = 10.1016/j.bmcl.2007.03.066 |url=}}</ref>
 
}}</ref>MTEP is both more [[Potency (pharmacology)|potent]] and more [[Functional selectivity|selective]] than [[2-Methyl-6-(phenylethynyl)pyridine|MPEP]] as a mGluR5 antagonist,<ref>{{Citecite journal | last1vauthors = SzydlowskaLea PM, Faden AI | first1title = K.Metabotropic glutamate receptor subtype 5 antagonists MPEP and MTEP | last2journal = KaminskaCNS Drug Reviews | first2volume = B.12 | last3issue = Baude2 | first3pages = A.149–166 | last4year = Parsons2006 | first4pmid = C. G.16958988 | last5pmc = Danysz6494124 | first5doi = W10.1111/j.1527-3458.2006.00149.x }}</ref> and produces similar [[neuroprotective]],<ref>{{cite journal | vauthors = Lea PM, Movsesyan VA, Faden AI | title = Neuroprotective activity of selectivethe mGlu1mGluR5 antagonists MPEP and mGlu5MTEP antagonistsagainst inacute vitroexcitotoxicity differs and indoes vivonot |reflect doiactions =at 10.1016/j.ejphar.2006.09.061mGluR5 receptors | journal = EuropeanBritish Journal of Pharmacology | volume = 554145 | issue = 14 | pages = 18–29527–534 | yeardate = 2007June 2005 | pmid = 15821750 17109843| pmc = 1576169 | doi = 10.1038/sj.bjp.0706219 }}</ref> [[antidepressant]],<ref>{{Citecite journal | last1vauthors = PałuchaDomin H, Kajta M, Smiałowska M | first1title = A.Neuroprotective effects of MTEP, a selective mGluR5 antagonists and neuropeptide Y on the kainate-induced toxicity in primary neuronal cultures | last2journal = BrańskiPharmacological Reports | first2volume = P.58 | last3issue = Szewczyk6 | first3pages = 846–858 | year = 2006 | pmid = 17220542 }}</ref><ref>{{cite journal | vauthors = Szydlowska K, Kaminska B., Baude A, Parsons CG, Danysz W | last4title = WierońskaNeuroprotective activity of selective mGlu1 and mGlu5 antagonists in vitro and in vivo | first4journal = J.European M.Journal of Pharmacology | last5volume = Kłak554 | first5issue = K.1 | last6pages = Pilc18–29 | first6date = A.January 2007 | pmid = 17109843 | doi = 10.1016/j.pbbejphar.20052006.0609.015061 }}</ref> [[antidepressant]],<ref>{{cite journal | vauthors = Pałucha A, Brański P, Szewczyk B, Wierońska JM, Kłak K, Pilc A | title = Potential antidepressant-like effect of MTEP, a potent and highly selective mGluR5 antagonist | journal = Pharmacology, Biochemistry, and Behavior | volume = 81 | issue = 4 | pages = 901901–906 | yeardate = August 2005 | pmid = 16040106 | pmcdoi = 10.1016/j.pbb.2005.06.015 | s2cid = 42920507 }}</ref><ref>{{Citecite journal | last1vauthors = Molina-Hernández | first1 = M. | last2 =, Tellez-Alcántara | first2 = N. P. | last3 =NP, Pérez-García | first3 = J. N. | last4 =, Olivera-Lopez | first4 = J. I. N. | last5 =JI, Jaramillo | first5 = M. T.MT | title = Antidepressant-like and anxiolytic-like actions of the mGlu5 receptor antagonist MTEP, microinjected into lateral septal nuclei of male Wistar rats | doi = 10.1016/j.pnpbp.2006.04.022 | journal = Progress in Neuro-Psychopharmacology and& Biological Psychiatry | volume = 30 | issue = 6 | pages = 1129–1135 | yeardate = August 2006 | pmid = 16759778 | pmcdoi = 10.1016/j.pnpbp.2006.04.022 | s2cid = 45937198 }}</ref><ref>{{Citecite journal | last1vauthors = Li | first1 = X. | last2 =, Need | first2 = A. B. | last3 =AB, Baez | first3 = M. | last4 =, Witkin | first4 = J. M.JM | title = Metabotropic Glutamateglutamate 5 Receptorreceptor Antagonismantagonism is Associatedassociated with Antidepressantantidepressant-Likelike Effectseffects in Micemice | doijournal = 10.1124/jpet.106.103143 | journal =The Journal of Pharmacology and Experimental Therapeutics | volume = 319 | issue = 1 | pages = 254–259 | yeardate = October 2006 | pmid = 16803860 | pmcdoi = 10.1124/jpet.106.103143 | s2cid = 14632318 }}</ref><ref>{{Citecite journal | last1vauthors = Belozertseva | first1 = I. | last2 =IV, Kos | first2 = T. | last3 =, Popik | first3 = P. | last4 =, Danysz | first4 = W. | last5 =, Bespalov | first5 = A.AY | title = Antidepressant-like effects of mGluR1 and mGluR5 antagonists in the rat forced swim and the mouse tail suspension tests | doi = 10.1016/j.euroneuro.2006.03.002 | journal = European Neuropsychopharmacology | volume = 17 | issue = 3 | pages = 172–179 | yeardate = February 2007 | pmid = 16630709 | pmcdoi = 10.1016/j.euroneuro.2006.03.002 | s2cid = 2420850 }}</ref> [[analgesic]],<ref>{{Citecite journal | last1vauthors = Zhu | first1 = C. Z. | last2 =CZ, Wilson | first2 = S. G. | last3 =SG, Mikusa | first3 = J. P. | last4 =JP, Wismer | first4 = C. T. | last5 =CT, Gauvin | first5 = D. M. | last6 =DM, Lynch Jj | first6 = J. J. | last7 =JJ, Wade | first7 = C. L. | last8 =CL, Decker | first8 = M. W. | last9 =MW, Honore | first9 = P. | doidisplay-authors = 10.1016/j.ejphar.2004.11.0056 | title = Assessing the role of metabotropic glutamate receptor 5 in multiple nociceptive modalities | journal = European Journal of Pharmacology | volume = 506 | issue = 2 | pages = 107–118 | yeardate = December 2004 | pmid = 15588730 | pmcdoi = 10.1016/j.ejphar.2004.11.005 }}</ref><ref>{{Citecite journal | last1vauthors = Varty | first1 = G. B. | last2 =GB, Grilli | first2 = M. | last3 =, Forlani | first3 = A. | last4 =, Fredduzzi | first4 = S. | last5 =, Grzelak | first5 = M. E. | last6 =ME, Guthrie | first6 = D. H. | last7 =DH, Hodgson | first7 = R. A. | last8 =RA, Lu | first8 = S. X. | last9 =SX, Nicolussi | first9 = E. | doi = 10.1007/s00213-005-2143-4 | last10 =, Pond | first10 = A. J. | last11 =AJ, Parker | first11 = E. M. | last12 =EM, Hunter | first12 = J. C. | last13 =JC, Higgins | first13 = G. A. | last14 =GA, Reggiani | first14 = A., |Bertorelli last15 = BertorelliR | first15display-authors = R.6 | title = The antinociceptive and anxiolytic-like effects of the metabotropic glutamate receptor 5 (mGluR5) antagonists, MPEP and MTEP, and the mGluR1 antagonist, LY456236, in rodents: Aa comparison of efficacy and side-effect profiles | journal = Psychopharmacology | volume = 179 | issue = 1 | pages = 207–217 | yeardate = April 2005 | pmid = 15682298 | pmcdoi = 10.1007/s00213-005-2143-4 | s2cid = 21807900 }}</ref> and [[anxiolytic]] effects but with either similar or higher [[efficacy]] depending on the test used.<ref>{{Citecite journal | last1vauthors = Klodzinska | first1 = A. | last2 =, Tatarczyńska | first2 = E. | last3 =, Chojnacka-Wójcik | first3 = E. | last4 =, Nowak | first4 = G. | last5 =, Cosford | first5 = N. D. P. | last6 =ND, Pilc | first6 = A. | doi = 10.1016/j.neuropharm.2004.04.013 | title = Anxiolytic-like effects of MTEP, a potent and selective mGlu5 receptor agonist does not involve GABAAGABA(A) signaling | journal = Neuropharmacology | volume = 47 | issue = 3 | pages = 342–350 | yeardate = September 2004 | pmid = 15275823 | pmcdoi = 10.1016/j.neuropharm.2004.04.013 | s2cid = 54432014 }}</ref><ref>{{Citecite journal | last1vauthors = Busse | first1 = C. S. | last2 =CS, Brodkin | first2 = J. | last3 =, Tattersall | first3 = D. | last4 =, Anderson | first4 = J. J. | last5 =JJ, Warren | first5 = N. | last6 =, Tehrani | first6 = L. | last7 =, Bristow | first7 = L. J. | last8 =LJ, Varney | first8 = M. A. | last9 =MA, Cosford | first9 = N. D.ND | doidisplay-authors = 10.1038/sj.npp.13005406 | title = The Behavioralbehavioral Profileprofile of the Potentpotent and Selectiveselective mGlu5 Receptorreceptor Antagonistantagonist 3-\[(2-methyl-1,3-thiazol-4-yl)ethynyl]pyridine (MTEP) in Rodentrodent Modelsmodels of Anxietyanxiety | journal = Neuropsychopharmacology | volume = 29 | issue = 11 | pages = 1971–1979 | yeardate = November 2004 | pmid = 15305166 | pmcdoi = 10.1038/sj.npp.1300540 | doi-access = free }}</ref><ref>{{Citecite journal | last1vauthors = Pietraszek | first1 = M. G. | last2 =, Sukhanov | first2 = I., | last3 = MacIejak | first3 =Maciejak P. | last4 =, Szyndler | first4 = J. | last5 =, Gravius | first5 = A. | last6 =, Wisłowska | first6 = A. | last7 =, Płaźnik | first7 = A. | last8 =, Bespalov | first8 = A. Y. | last9 =AY, Danysz | first9 = W. | doidisplay-authors = 10.1016/j.ejphar.2005.03.0286 | title = Anxiolytic-like effects of mGlu1 and mGlu5 receptor antagonists in rats | journal = European Journal of Pharmacology | volume = 514 | issue = 1 | pages = 25–34 | yeardate = May 2005 | pmid = 15878321 | pmcdoi = 10.1016/j.ejphar.2005.03.028 }}</ref><ref>{{Citecite journal | last1vauthors = Stachowicz | first1 = K. | last2 =, Gołembiowska | first2 = K. | last3 =, Sowa | first3 = M. | last4 =, Nowak | first4 = G. | last5 =, Chojnacka-Wójcik | first5 = E. | last6 =, Pilc | first6 = A. | doi = 10.1016/j.neuropharm.2007.08.002 | title = Anxiolytic-like action of MTEP expressed in the conflict drinking Vogel test in rats is serotonin dependent | journal = Neuropharmacology | volume = 53 | issue = 6 | pages = 741–748 | yeardate = November 2007 | pmid = 17870136 | pmcdoi = 10.1016/j.neuropharm.2007.08.002 | s2cid = 24833690 }}</ref>
MTEP is both more [[Potency (pharmacology)|potent]] and more [[Functional selectivity|selective]] than MPEP as a mGluR5 antagonist,<ref>{{Cite journal | last1 = Lea | first1 = P. M. | last2 = Faden | first2 = A. I. | doi = 10.1111/j.1527-3458.2006.00149.x | title = Metabotropic Glutamate Receptor Subtype 5 Antagonists MPEP and MTEP | journal = CNS Drug Reviews | volume = 12 | issue = 2 | pages = 149–166 | year = 2006 | pmid = 16958988| pmc = }}</ref> and produces similar [[neuroprotective]],<ref>{{Cite journal | last1 = Lea | first1 = P. M. | last2 = Movsesyan | first2 = V. A. | last3 = Faden | first3 = A. I. | doi = 10.1038/sj.bjp.0706219 | title = Neuroprotective activity of the mGluR5 antagonists MPEP and MTEP against acute excitotoxicity differs and does not reflect actions at mGluR5 receptors | journal = British Journal of Pharmacology | volume = 145 | issue = 4 | pages = 527–534 | year = 2009 | pmid = 15821750| pmc =1576169 }}</ref><ref>{{Cite journal
| last1 = Domin | first1 = H.
| last2 = Kajta | first2 = M.
| last3 = Smiałowska | first3 = M.
| title = Neuroprotective effects of MTEP, a selective mGluR5 antagonists and neuropeptide Y on the kainate-induced toxicity in primary neuronal cultures
| journal = Pharmacological reports : PR
| volume = 58
| issue = 6
| pages = 846–858
| year = 2006
| pmid = 17220542
}}</ref><ref>{{Cite journal | last1 = Szydlowska | first1 = K. | last2 = Kaminska | first2 = B. | last3 = Baude | first3 = A. | last4 = Parsons | first4 = C. G. | last5 = Danysz | first5 = W. | title = Neuroprotective activity of selective mGlu1 and mGlu5 antagonists in vitro and in vivo | doi = 10.1016/j.ejphar.2006.09.061 | journal = European Journal of Pharmacology | volume = 554 | issue = 1 | pages = 18–29 | year = 2007 | pmid = 17109843| pmc = }}</ref> [[antidepressant]],<ref>{{Cite journal | last1 = Pałucha | first1 = A. | last2 = Brański | first2 = P. | last3 = Szewczyk | first3 = B. | last4 = Wierońska | first4 = J. M. | last5 = Kłak | first5 = K. | last6 = Pilc | first6 = A. | doi = 10.1016/j.pbb.2005.06.015 | title = Potential antidepressant-like effect of MTEP, a potent and highly selective mGluR5 antagonist | journal = Pharmacology Biochemistry and Behavior | volume = 81 | issue = 4 | pages = 901 | year = 2005 | pmid = | pmc = }}</ref><ref>{{Cite journal | last1 = Molina-Hernández | first1 = M. | last2 = Tellez-Alcántara | first2 = N. P. | last3 = Pérez-García | first3 = J. N. | last4 = Olivera-Lopez | first4 = J. I. N. | last5 = Jaramillo | first5 = M. T. | title = Antidepressant-like and anxiolytic-like actions of the mGlu5 receptor antagonist MTEP, microinjected into lateral septal nuclei of male Wistar rats | doi = 10.1016/j.pnpbp.2006.04.022 | journal = Progress in Neuro-Psychopharmacology and Biological Psychiatry | volume = 30 | issue = 6 | pages = 1129–1135 | year = 2006 | pmid = 16759778| pmc = }}</ref><ref>{{Cite journal | last1 = Li | first1 = X. | last2 = Need | first2 = A. B. | last3 = Baez | first3 = M. | last4 = Witkin | first4 = J. M. | title = Metabotropic Glutamate 5 Receptor Antagonism is Associated with Antidepressant-Like Effects in Mice | doi = 10.1124/jpet.106.103143 | journal = Journal of Pharmacology and Experimental Therapeutics | volume = 319 | issue = 1 | pages = 254–259 | year = 2006 | pmid = 16803860| pmc = }}</ref><ref>{{Cite journal | last1 = Belozertseva | first1 = I. | last2 = Kos | first2 = T. | last3 = Popik | first3 = P. | last4 = Danysz | first4 = W. | last5 = Bespalov | first5 = A. | title = Antidepressant-like effects of mGluR1 and mGluR5 antagonists in the rat forced swim and the mouse tail suspension tests | doi = 10.1016/j.euroneuro.2006.03.002 | journal = European Neuropsychopharmacology | volume = 17 | issue = 3 | pages = 172–179 | year = 2007 | pmid = 16630709| pmc = }}</ref> [[analgesic]],<ref>{{Cite journal | last1 = Zhu | first1 = C. Z. | last2 = Wilson | first2 = S. G. | last3 = Mikusa | first3 = J. P. | last4 = Wismer | first4 = C. T. | last5 = Gauvin | first5 = D. M. | last6 = Lynch Jj | first6 = J. J. | last7 = Wade | first7 = C. L. | last8 = Decker | first8 = M. W. | last9 = Honore | first9 = P. | doi = 10.1016/j.ejphar.2004.11.005 | title = Assessing the role of metabotropic glutamate receptor 5 in multiple nociceptive modalities | journal = European Journal of Pharmacology | volume = 506 | issue = 2 | pages = 107–118 | year = 2004 | pmid = 15588730| pmc = }}</ref><ref>{{Cite journal | last1 = Varty | first1 = G. B. | last2 = Grilli | first2 = M. | last3 = Forlani | first3 = A. | last4 = Fredduzzi | first4 = S. | last5 = Grzelak | first5 = M. E. | last6 = Guthrie | first6 = D. H. | last7 = Hodgson | first7 = R. A. | last8 = Lu | first8 = S. X. | last9 = Nicolussi | first9 = E. | doi = 10.1007/s00213-005-2143-4 | last10 = Pond | first10 = A. J. | last11 = Parker | first11 = E. M. | last12 = Hunter | first12 = J. C. | last13 = Higgins | first13 = G. A. | last14 = Reggiani | first14 = A. | last15 = Bertorelli | first15 = R. | title = The antinociceptive and anxiolytic-like effects of the metabotropic glutamate receptor 5 (mGluR5) antagonists, MPEP and MTEP, and the mGluR1 antagonist, LY456236, in rodents: A comparison of efficacy and side-effect profiles | journal = Psychopharmacology | volume = 179 | issue = 1 | pages = 207–217 | year = 2005 | pmid = 15682298| pmc = }}</ref> and [[anxiolytic]] effects but with either similar or higher [[efficacy]] depending on the test used.<ref>{{Cite journal | last1 = Klodzinska | first1 = A. | last2 = Tatarczyńska | first2 = E. | last3 = Chojnacka-Wójcik | first3 = E. | last4 = Nowak | first4 = G. | last5 = Cosford | first5 = N. D. P. | last6 = Pilc | first6 = A. | doi = 10.1016/j.neuropharm.2004.04.013 | title = Anxiolytic-like effects of MTEP, a potent and selective mGlu5 receptor agonist does not involve GABAA signaling | journal = Neuropharmacology | volume = 47 | issue = 3 | pages = 342–350 | year = 2004 | pmid = 15275823| pmc = }}</ref><ref>{{Cite journal | last1 = Busse | first1 = C. S. | last2 = Brodkin | first2 = J. | last3 = Tattersall | first3 = D. | last4 = Anderson | first4 = J. J. | last5 = Warren | first5 = N. | last6 = Tehrani | first6 = L. | last7 = Bristow | first7 = L. J. | last8 = Varney | first8 = M. A. | last9 = Cosford | first9 = N. D. | doi = 10.1038/sj.npp.1300540 | title = The Behavioral Profile of the Potent and Selective mGlu5 Receptor Antagonist 3-\(2-methyl-1,3-thiazol-4-yl)ethynyl]pyridine (MTEP) in Rodent Models of Anxiety | journal = Neuropsychopharmacology | volume = 29 | issue = 11 | pages = 1971–1979 | year = 2004 | pmid = 15305166| pmc = }}</ref><ref>{{Cite journal | last1 = Pietraszek | first1 = M. G. | last2 = Sukhanov | first2 = I. | last3 = MacIejak | first3 = P. | last4 = Szyndler | first4 = J. | last5 = Gravius | first5 = A. | last6 = Wisłowska | first6 = A. | last7 = Płaźnik | first7 = A. | last8 = Bespalov | first8 = A. Y. | last9 = Danysz | first9 = W. | doi = 10.1016/j.ejphar.2005.03.028 | title = Anxiolytic-like effects of mGlu1 and mGlu5 receptor antagonists in rats | journal = European Journal of Pharmacology | volume = 514 | issue = 1 | pages = 25–34 | year = 2005 | pmid = 15878321| pmc = }}</ref><ref>{{Cite journal | last1 = Stachowicz | first1 = K. | last2 = Gołembiowska | first2 = K. | last3 = Sowa | first3 = M. | last4 = Nowak | first4 = G. | last5 = Chojnacka-Wójcik | first5 = E. | last6 = Pilc | first6 = A. | doi = 10.1016/j.neuropharm.2007.08.002 | title = Anxiolytic-like action of MTEP expressed in the conflict drinking Vogel test in rats is serotonin dependent | journal = Neuropharmacology | volume = 53 | issue = 6 | pages = 741–748 | year = 2007 | pmid = 17870136| pmc = }}</ref>
 
MTEP also has similar efficacy to MPEP in reducing the symptoms of [[morphine]] [[Drug withdrawal|withdrawal]],<ref>{{cite journal |author vauthors = Pałucha A, Brański P, Pilc A | title = Selective mGlu5 receptor antagonist MTEP attenuates naloxone-induced morphine with-drawalwithdrawal symptoms | journal =Pol JPolish PharmacolJournal of Pharmacology | volume = 56 | issue = 6 | pages =863–6 863–866 | year = 2004 | pmid = 15662102 |doi= |url = http://www.if-pan.krakow.pl/pjp/pdf/2004/6_863.pdf }}</ref><ref>{{cite journal |author vauthors = Rasmussen K, Martin H, Berger JE, Seager MA | title = The mGlu5 receptor antagonists MPEP and MTEP attenuate behavioral signs of morphine withdrawal and morphine-withdrawal-induced activation of locus coeruleus neurons in rats | journal = Neuropharmacology | volume = 48 | issue = 2 | pages =173–80 173–180 | date = February 2005 | pmid = 15695156 | doi = 10.1016/j.neuropharm.2004.09.010 |url s2cid = 13552709 }}</ref><ref>{{cite journal |author vauthors = Kotlinska J, Bochenski M | title = Comparison of the effects of mGluR1 and mGluR5 antagonists on the expression of behavioral sensitization to the locomotor effect of morphine and the morphine withdrawal jumping in mice | journal =Eur. J.European Pharmacol.Journal of Pharmacology | volume = 558 | issue =1-3 1–3 | pages =113–8 113–118 | date = March 2007 | pmid = 17222405 | doi = 10.1016/j.ejphar.2006.11.067 |url=}}</ref> and has anti-addictive effects in a variety of animal models, both reducing ethanol self-administration,<ref>{{cite journal |author vauthors = Cowen MS, Djouma E, Lawrence AJ | title = The metabotropic glutamate 5 receptor antagonist 3-[(2-methyl-1,3-thiazol-4-yl)ethynyl]-pyridine reduces ethanol self-administration in multiple strains of alcohol-preferring rats and regulates olfactory glutamatergic systems | journal =J. Pharmacol.The Exp.Journal Ther.of Pharmacology and Experimental Therapeutics | volume = 315 | issue = 2 | pages = 590–600 | date = November 2005 | pmid = 16014750 | doi = 10.1124/jpet.105.090449 |url s2cid = 11501029 }}</ref><ref>{{cite journal |author vauthors = Cowen MS, Krstew E, Lawrence AJ | title = Assessing appetitive and consummatory phases of ethanol self-administration in C57BL/6J mice under operant conditions: regulation by mGlu5 receptor antagonism | journal = Psychopharmacology (Berl.) | volume = 190 | issue = 1 | pages =21–9 21–29 | date = January 2007 | pmid = 17096086 | doi = 10.1007/s00213-006-0583-0 |url s2cid = 19977179 }}</ref><ref>{{cite journal |author vauthors = Adams CL, Cowen MS, Short JL, Lawrence AJ | title = Combined antagonism of glutamate mGlu5 and adenosine A2A receptors interact to regulate alcohol-seeking in rats | journal =Int. J.The Neuropsychopharmacol.International Journal of Neuropsychopharmacology | volume = 11 | issue = 2 | pages =229–41 229–241 | date = March 2008 | pmid = 17517168 | doi = 10.1017/S1461145707007845 |url doi-access = free | hdl = 11343/32923 | hdl-access = free }}</ref><ref>{{cite journal |author vauthors = Kotlinska J, Bochenski M | title = The influence of various glutamate receptors antagonists on anxiety-like effect of ethanol withdrawal in a plus-maze test in rats | journal =Eur. J.European Pharmacol.Journal of Pharmacology | volume = 598 | issue =1-3 1–3 | pages = 57–63 | date = November 2008 | pmid = 18838071 | doi = 10.1016/j.ejphar.2008.09.026 |url=}}</ref> and also decreasing the addictive effects of [[nicotine]], [[cocaine]] and [[methamphetamine]].<ref>{{cite journal |author vauthors = Dravolina OA, Danysz W, Bespalov AY | title = Effects of group I metabotropic glutamate receptor antagonists on the behavioral sensitization to motor effects of cocaine in rats | journal = Psychopharmacology (Berl.) | volume = 187 | issue = 4 | pages = 397–404 | date = September 2006 | pmid = 16896963 | doi = 10.1007/s00213-006-0440-1 |url s2cid = 21231365 }}</ref><ref>{{cite journal |author vauthors = Palmatier MI, Liu X, Donny EC, Caggiula AR, Sved AF | title = Metabotropic glutamate 5 receptor (mGluR5) antagonists decrease nicotine seeking, but do not affect the reinforcement enhancing effects of nicotine | journal = Neuropsychopharmacology | volume = 33 | issue = 9 | pages =2139–47 2139–2147 | date = August 2008 | pmid = 18046312 | pmc = 2812904 | doi = 10.1038/sj.npp.1301623 |url= |pmc=2812904}}</ref><ref>{{cite journal |author vauthors = Gass JT, Osborne MP, Watson NL, Brown JL, Olive MF | title = mGluR5 antagonism attenuates methamphetamine reinforcement and prevents reinstatement of methamphetamine-seeking behavior in rats | journal = Neuropsychopharmacology | volume = 34 | issue = 4 | pages =820–33 820–833 | date = March 2009 | pmid = 18800068 | pmc = 2669746 | doi = 10.1038/npp.2008.140 |url=}}</ref><ref>{{cite journal |author vauthors = Osborne MP, Olive MF | title = A role for mGluR5 receptors in intravenous methamphetamine self-administration | journal =Ann. N.Annals Y.of Acad.the Sci.New York Academy of Sciences | volume = 1139 | issue = 1 | pages =206–11 206–211 | date = October 2008 | pmid = 18991866 | doi = 10.1196/annals.1432.034 |url s2cid = 207012906 | bibcode = 2008NYASA1139..206O }}</ref><ref>{{cite journal |author vauthors = Martin-Fardon R, Baptista MA, Dayas CV, Weiss F | title = Dissociation of the effects of MTEP [3-[(2-methyl-1,3-thiazol-4-yl)ethynyl]piperidine] on conditioned reinstatement and reinforcement: comparison between cocaine and a conventional reinforcer | journal =J. Pharmacol.The Exp.Journal Ther.of Pharmacology and Experimental Therapeutics | volume = 329 | issue = 3 | pages =1084–90 1084–1090 | date = June 2009 | pmid = 19258516 | pmc = 2683783 | doi = 10.1124/jpet.109.151357 |url= |pmc=2683783}}</ref>
 
==References See also ==
*[[2-Methyl-6-(phenylethynyl)pyridine|MPEP]]
*[[MFZ 10-7]]
*[[Fenobam]]
 
== References ==
{{Reflist|30em}}
 
{{Metabotropic glutamate receptor modulators}}
{{Glutamatergics}}
 
[[Category:Thiazoles]]
[[Category:Pyridines3-Pyridyl compounds]]
[[Category:AlkynesAlkyne derivatives]]
[[Category:MGlu5 receptor antagonists]]
 
 
{{nervous-system-drug-stub}}