CSPD (molecule): Difference between revisions

| verifiedrevid = 435669125

| ImageFile = CSPD structure.svg

| ImageSize = 200px

| Name = CSPD

| IUPACName = 3-(1-Chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl)phenyl] dihydrogen phosphate

|Section1={{Chembox Identifiers

| CASNo = 142456-88-0

| CASNo1 = 142849-53-4

| CASNo1_Comment = (disodium salt)

| PubChem = 64633

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| SMILES = COC1(C2(C3CC4CC2CC(C4)(C3)Cl)OO1)c5cccc(c5)OP(=O)(O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

|Section2={{Chembox Properties

| C=18 | H=22 | Cl=1 | O=7 | P=1

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

'''CSPD''' ('''[3-(1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl)phenyl] dihydrogen phosphate''') is a [[chemical substance]] with formula C₁₈H₂₂ClO₇P. It is a component of [[enhanced chemiluminescence]] [[enzyme-linked immunosorbent assay]] (ELISA) kits, used for the detection of minute amounts of various substances such as proteins.<ref>{{Cite journal | doi = 10.1016/0009-9120(93)90108-I| title = Ultrasensitive immunoassay techniques| journal = Clinical Biochemistry| volume = 26| issue = 5| pages = 325–331| year = 1993| last1 = Kricka| first1 = Larry J| pmid = 8299202| doi-access = free}}</ref>

==Properties==

The molecule CSPD has the following functional groups in the structure: phosphate group, phenyl group, spiro group, methyl ether group, and chlorine group. The ones worth noting are the ones above. None of these groups carry a charge. If there was a charge this would have had a change in the compound's pH, 3D structure, mass and bond angles.<ref>{{Cite web|last=PubChem|title=[3-(1-Chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl)phenyl] dihydrogen phosphate|url=https://pubchem.ncbi.nlm.nih.gov/compound/64633|access-date=2021-11-18|website=pubchem.ncbi.nlm.nih.gov|language=en}}</ref>

The toxin CSPD effect persister cell formation using MqsR (MqsR, a crucial regulator for quorum sensing and biofilm formation, is a GCU-specific mRNA interferase in ''Escherichia coli''<ref>{{Cite web|title=mqsR - mRNA interferase toxin MqsR - Escherichia coli (strain K12) - mqsR gene & protein|url=https://www.uniprot.org/uniprot/Q46865#:~:text=%22MqsR,%20a%20crucial%20regulator%20for,mRNA%20interferase%20in%20Escherichia%20coli.%22|access-date=2021-11-19|website=www.uniprot.org|language=en}}</ref>) and persister cells are cells that avoid stress and are characterized by reduced metabolism and other factors.<ref>{{Cite journal|last1=Kim|first1=Younghoon|last2=Wood|first2=Thomas K.|date=2010-01-01|title=Toxins Hha and CspD and small RNA regulator Hfq are involved in persister cell formation through MqsR in Escherichia coli|journal=Biochemical and Biophysical Research Communications|language=en|volume=391|issue=1|pages=209–213|doi=10.1016/j.bbrc.2009.11.033|pmid=19909729|pmc=2812665|issn=0006-291X}}</ref>{{Clarify|date=May 2023}}

<!--Bronstein, WO 88/00695; Schaap, et al. EPO 254,051; and Schaap, et al. (1987)-->

<!-- Enhancement of chemiluminescent 1,2-dioxetane-based assays and kits for conducting said assays. United States Patent 5654154 [http://www.freepatentsonline.com/5654154.html]-->

[[Category:Chemiluminescence]]

[[Category:Adamantanes]]

[[Category:Dioxetanes]]

[[Category:Organic peroxides]]

[[Category:Organochlorides]]

[[Category:Organophosphates]]

[[Category:Phenol esters]]

[[Category:Spiro compounds]]

{{Biochem-stub}}