Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Vindesine: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{drugbox}} taken from revid 457795730 of page Vindesine for the Chem/Drugbox validation project (updated: 'DrugBank').
 
Importing Wikidata short description: "Chemical compound"
 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Vindesine|oldid=457795730}} 457795730] of page [[Vindesine]] with values updated to verified values.}}
{{Drugbox
{{Drugbox
⚫
| verifiedrevid = 470630451
| Verifiedfields = changed
⚫
| verifiedrevid = 457794905
| IUPAC_name = methyl (5''S'',7''S'',9''S'')- 9-[(2β,3β,4β,5α,12β,19α)- 3-(aminocarbonyl)- 3,4-dihydroxy- 16-methoxy- 1-methyl- 6,7-didehydroaspidospermidin- 15-yl]- 5-ethyl- 5-hydroxy- 1,4,5,6,7,8,9,10-octahydro- 2''H''- 3,7-methanoazacycloundecino[5,4-''b'']indole- 9-carboxylate
| IUPAC_name = methyl (5''S'',7''S'',9''S'')- 9-[(2β,3β,4β,5α,12β,19α)- 3-(aminocarbonyl)- 3,4-dihydroxy- 16-methoxy- 1-methyl- 6,7-didehydroaspidospermidin- 15-yl]- 5-ethyl- 5-hydroxy- 1,4,5,6,7,8,9,10-octahydro- 2''H''- 3,7-methanoazacycloundecino[5,4-''b'']indole- 9-carboxylate
| image = Vindesin.svg
| image = Vindesin.svg
| image2 = Vindesine ball-and-stick animation.gif


<!--Clinical data-->
<!--Clinical data-->
Line 23: Line 23:


<!--Identifiers-->
<!--Identifiers-->
| index2_label = Sulfate
⚫
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number2_Ref = {{cascite|correct|CAS}}
⚫
| CAS_number = 59917-39-4
| CAS_number2 = 59917-39-4
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = CPH2U7DNDY
⚫
| CAS_number_Ref = {{cascite|correct|CAS}}
⚫
| CAS_number = 53643-48-4
| ATC_prefix = L01
| ATC_prefix = L01
| ATC_suffix = CA03
| ATC_suffix = CA03
Line 30: Line 35:
| ChEMBL = 219146
| ChEMBL = 219146
| PubChem = 40839
| PubChem = 40839
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00309
| DrugBank = DB00309
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 37302
| ChemSpiderID = 37302
Line 43: Line 48:
<!--Chemical data-->
<!--Chemical data-->
| C=43 | H=55 | N=5 | O=7
| C=43 | H=55 | N=5 | O=7
⚫
| smiles = O=C(OC)[C@]4(c2c(c1ccccc1[nH]2)CCN3C[C@](O)(CC)C[C@@H](C3)C4)c5c(OC)cc6c(c5)[C@@]89[C@@H](N6C)[C@@](O)(C(=O)N)[C@H](O)[C@@]7(/C=C\CN([C@@H]78)CC9)CC
| molecular_weight = 753.926 g/mol
⚫
| smiles = O=C(OC)[C@]4(c2c(c1ccccc1n2)CCN3C[C@](O)(CC)C[C@@H](C3)C4)c5c(OC)cc6c(c5)[C@@]89[C@@H](N6C)[C@@](O)(C(=O)N)[C@H](O)[C@@]7(/C=C\CN([C@@H]78)CC9)CC
| InChI = 1/C43H55N5O7/c1-6-39(52)21-25-22-42(38(51)55-5,33-27(13-17-47(23-25)24-39)26-11-8-9-12-30(26)45-33)29-19-28-31(20-32(29)54-4)46(3)35-41(28)15-18-48-16-10-14-40(7-2,34(41)48)36(49)43(35,53)37(44)50/h8-12,14,19-20,25,34-36,45,49,52-53H,6-7,13,15-18,21-24H2,1-5H3,(H2,44,50)/t25-,34+,35-,36-,39+,40-,41-,42+,43+/m1/s1
| InChIKey = HHJUWIANJFBDHT-KOTLKJBCBW
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C43H55N5O7/c1-6-39(52)21-25-22-42(38(51)55-5,33-27(13-17-47(23-25)24-39)26-11-8-9-12-30(26)45-33)29-19-28-31(20-32(29)54-4)46(3)35-41(28)15-18-48-16-10-14-40(7-2,34(41)48)36(49)43(35,53)37(44)50/h8-12,14,19-20,25,34-36,45,49,52-53H,6-7,13,15-18,21-24H2,1-5H3,(H2,44,50)/t25-,34+,35-,36-,39+,40-,41-,42+,43+/m1/s1
| StdInChI = 1S/C43H55N5O7/c1-6-39(52)21-25-22-42(38(51)55-5,33-27(13-17-47(23-25)24-39)26-11-8-9-12-30(26)45-33)29-19-28-31(20-32(29)54-4)46(3)35-41(28)15-18-48-16-10-14-40(7-2,34(41)48)36(49)43(35,53)37(44)50/h8-12,14,19-20,25,34-36,45,49,52-53H,6-7,13,15-18,21-24H2,1-5H3,(H2,44,50)/t25-,34+,35-,36-,39+,40-,41-,42+,43+/m1/s1
Line 52: Line 54:
| StdInChIKey = HHJUWIANJFBDHT-KOTLKJBCSA-N
| StdInChIKey = HHJUWIANJFBDHT-KOTLKJBCSA-N
}}
}}

'''Vindesine''', also termed Eldisine, is a [[Semisynthesis|semisynthetic]] [[vinca alkaloid]] derived from the flowering plant ''[[Catharanthus roseus]].''<ref name="pmid31228447">{{cite journal | vauthors = Mondal A, Gandhi A, Fimognari C, Atanasov AG, Bishayee A | title = Alkaloids for cancer prevention and therapy: Current progress and future perspectives | journal = European Journal of Pharmacology | volume = 858 | pages = 172472 | date = September 2019 | pmid = 31228447 | doi = 10.1016/j.ejphar.2019.172472 | s2cid = 195298770 }}</ref> Like the natural (e.g. [[vinblastine]] and [[vincristine]]) and semisynthetic vinca alkaloids (e.g. [[vinorelbine]] and [[vinflunine]]) derived from this plant, vindesine is an [[mitotic inhibitor|inhibitor of mitosis]] that is used as a [[chemotherapy]] drug.<ref name="pmid30122223">{{cite journal | vauthors = Martino E, Casamassima G, Castiglione S, Cellupica E, Pantalone S, Papagni F, Rui M, Siciliano AM, Collina S | title = Vinca alkaloids and analogues as anti-cancer agents: Looking back, peering ahead | journal = Bioorganic & Medicinal Chemistry Letters | volume = 28 | issue = 17 | pages = 2816–2826 | date = September 2018 | pmid = 30122223 | doi = 10.1016/j.bmcl.2018.06.044 | s2cid = 52039135 }}</ref> By inhibiting [[mitosis]], vinedsine blocks the proliferation of cells, particularly the rapidly proliferation cells of certain types of cancer. It is used, generally in combination with other chemotherapeutic drugs, in the treatment of various malignancies such as [[leukaemia]], [[lymphoma]], [[melanoma]], [[breast cancer]], and [[lung cancer]].<ref>{{cite web |url=https://www.cancerresearchuk.org/about-cancer/cancer-in-general/treatment/cancer-drugs/drugs/vindesine |title = Vindesine (Eldisine) {{!}} Cancer information {{!}} Cancer Research UK}}</ref>

== References ==
{{Reflist}}

{{Chemotherapeutic agents}}

[[Category:Vinca alkaloids]]
[[Category:Mitotic inhibitors]]

{{antineoplastic-drug-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"