Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Sodium sorbate: Difference between pages

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{short description|Chemical compound}}
-{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Sodium_sorbate|oldid=458851724}} 458851724] of page [[Sodium_sorbate]] with values updated to verified values.}}
 {{chembox
+| Verifiedfields = changed
-| verifiedrevid = 426369164
+| Watchedfields = changed
-|   Name = Sodium sorbate
+| verifiedrevid = 464404037
-|   ImageFile = Na-sorbat.svg
+| Name = Sodium sorbate
-|   ImageFileL1 = Sorbate-3D-balls.png
+| ImageFile = Sodium sorbate V.1.svg
-|   ImageSizeL1 = 180px
+| ImageFileL1 = Sorbate-3D-balls.png
-|   ImageNameL1 = Ball-and-stick model of the sorbate anion
+| ImageSizeL1 = 160px
-|   ImageFileR1 = Sodium-3D.png
-|   ImageSizeR1 = 60px
+| ImageNameL1 =
+| ImageFileR1 = Sodium-3D.png
-|   ImageNameR1 = The sodium cation
+| ImageSizeR1 = 160px
-|   IUPACName = sodium (2''E'',4''E'')-hexa-2,4-dienoate
+| ImageNameR1 = The sodium cation
-| Section1 = {{Chembox Identifiers
+| PIN = Sodium (2''E'',4''E'')-hexa-2,4-dienoate
-|   ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
+|Section1={{Chembox Identifiers
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 4938659
-| PubChem = 6433514
+| PubChem = 23665582
 | InChI = 1/C6H8O2.Na/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+;
 | InChIKey = LROWVYNUWKVTCU-ZCSOUONQBK
@@ Line 21: / Line 23: @@
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = LROWVYNUWKVTCU-STWYSWDKSA-M
-| CASNo_Ref = {{cascite|correct|??}}
+| CASNo_Ref = {{cascite|correct|CAS}}
-| CASNo = <!-- blanked - oldvalue: 7757-81-5 -->
+| CASNo = 7757-81-5
+| UNII_Ref = {{fdacite|correct|FDA}}
-|   SMILES = [Na+].[O-]C(=O)\C=C\C=C\C
+| UNII = TGW6Q2CCVM
+| SMILES = [Na+].[O-]C(=O)\C=C\C=C\C
 }}
-| Section2 = {{Chembox Properties
+|Section2={{Chembox Properties
-|   Formula = C<sub>6</sub>H<sub>7</sub>NaO<sub>2</sub>
+| Formula = C<sub>6</sub>H<sub>7</sub>NaO<sub>2</sub>
-|   MolarMass = 134.10835 g·mol<sup>−1</sup>
+| MolarMass = 134.10835 g/mol
+| Odor = hydrocarbon-like
-|   MeltingPt =
+| MeltingPt =
-|   BoilingPt = 233 °C<ref name="chemspider">[http://www.chemspider.com/Search.aspx?rid=34eae781-263e-40bb-a166-097647820393 Datenbankeintrag bei Chemspider]</ref>
+| BoilingPtC = 233
+| BoilingPt_ref = <ref name="chemspider">[http://www.chemspider.com/Search.aspx?rid=34eae781-263e-40bb-a166-097647820393 Datenbankeintrag bei Chemspider]</ref>
   }}
 }}
+'''Sodium sorbate''' is the [[sodium]] [[salt (chemistry)|salt]] of [[sorbic acid]].  It is an unstable white solid. Unlike other sorbic acid salts such as [[potassium sorbate]] (E202) and [[calcium sorbate]] (E203), the use of sodium sorbate as a [[food additive]] is prohibited in the EU due to potentially genotoxic effects.<ref>[https://www.efsa.europa.eu/it/efsajournal/pub/4144 EFSA Journal 2015]</ref><ref name=Ullmann>{{cite encyclopedia|author=Erich Lück, Martin Jager, Nico Raczek|title=Sorbic Acid|encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry|publisher=Wiley-VCH|location=Weinheim|year=2000|doi=10.1002/14356007.a24_507|isbn=3527306730 }}</ref>
+Its [[E number|E-number]] is E201.
+==References==
+{{Reflist}}
+[[Category:Organic sodium salts]]
+[[Category:Sorbates]]
+{{organic-compound-stub}}