Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and N-Acetylgalactosamine: Difference between pages

(Difference between pages)
Page 1
Page 2
Content deleted Content added
VisualWikitext
Saving copy of the {{chembox}} taken from revid 453570349 of page N-Acetylgalactosamine for the Chem/Drugbox validation project (updated: 'ChEBI', 'CASNo').
 
m Validated UNII
 
Line 1: Line 1:
{{short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:N-Acetylgalactosamine|oldid=453570349}} 453570349] of page [[N-Acetylgalactosamine]] with values updated to verified values.}}
⚫
{{DISPLAYTITLE:''N''-Acetylgalactosamine}}
{{Chembox
{{Chembox
| Verifiedfields = changed
⚫
| verifiedrevid = 453568861
| Watchedfields = changed
⚫
| Name=''N''-Acetylgalactosamine
⚫
| verifiedrevid = 462256808
| ImageFile = acetylgalactosamine.png
| Name =''N''-Acetylgalactosamine
| ImageFile = N-Acetylgalactosamine Structural Formula V.1.svg
| ImageSize = 150px
| ImageSize = 150px
| IUPACName = 2-(Acetylamino)-2-deoxy-<small>D</small>-galactose
| IUPACName = 2-(Acetylamino)-2-deoxy-<small>D</small>-galactose
| OtherNames = GalNAc; 2-Acetamido-2-deoxy-<small>D</small>-galactose; ''N''-Acetylchondrosamine; 2-Acetamido-2-deoxy-<small>D</small>-galactopyranose; ''N''-Acetyl-<small>D</small>-galactosamine
| OtherNames = GalNAc; 2-Acetamido-2-deoxy-<small>D</small>-galactose; ''N''-Acetylchondrosamine; 2-Acetamido-2-deoxy-<small>D</small>-galactopyranose; ''N''-Acetyl-<small>D</small>-galactosamine

| Section1 = {{Chembox Identifiers
| Section1 = {{Chembox Identifiers
| Abbreviations =
| Abbreviations =
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = <!-- blanked - oldvalue: 31022-50-1 -->
| CASNo = 1811-31-0
| EINECS =
| EINECS =
| PubChem = 84265
| PubChem = 84265
| SMILES = O[C@@H](C(CO)O[C@H](O)[C@H]1NC(C)=O)[C@H]1O
| SMILES = O[C@@H](C(CO)O[C@H](O)[C@H]1NC(C)=O)[C@H]1O
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 76020
| ChemSpiderID = 76020
| InChI = 1/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8+/m1/s1
| InChI = 1/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8+/m1/s1
| InChIKey = OVRNDRQMDRJTHS-CBQIKETKBW
| InChIKey = OVRNDRQMDRJTHS-CBQIKETKBW
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8+/m1/s1
| StdInChI = 1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OVRNDRQMDRJTHS-CBQIKETKSA-N
| StdInChIKey = OVRNDRQMDRJTHS-CBQIKETKSA-N
| RTECS =
| RTECS =
Line 26: Line 31:
| ChEBI = 40356
| ChEBI = 40356
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
| KEGG = C01074
| UNII_Ref = {{fdacite|correct|FDA}}
| ATCCode_prefix =
| UNII = 833755V695
| ATCCode_suffix =
| DrugBank = DB03567
| ATC_Supplemental =}}
}}

| Section2 = {{Chembox Properties
| Section2 = {{Chembox Properties
| C=8 | H=15 | N=1 | O=6
| Formula = C<sub>8</sub>H<sub>15</sub>NO<sub>6</sub>
| MolarMass = 221.21 g/mol
| MolarMass = 221.21 g/mol
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt = 172-173 °C
| MeltingPtC = 172 to 173
| MeltingPt_notes =
| Melting_notes =
| BoilingPt =
| BoilingPt =
| Boiling_notes =
| BoilingPt_notes =
| Solubility =
| Solubility =
| SolubleOther =
| SolubleOther =
Line 50: Line 57:
| RefractIndex =
| RefractIndex =
| Viscosity =
| Viscosity =
| Dipole = }}
| Dipole =
}}

| Section3 = {{Chembox Structure
| Section3 = {{Chembox Structure
| CrystalStruct =
| CrystalStruct =
| Coordination =
| Coordination =
| MolShape = }}
| MolShape =
}}

| Section4 = {{Chembox Thermochemistry
| Section4 = {{Chembox Thermochemistry
| DeltaHf =
| DeltaHf =
| DeltaHc =
| DeltaHc =
| Entropy =
| Entropy =
| HeatCapacity = }}
| HeatCapacity =
}}

| Section5 = {{Chembox Pharmacology
| Section5 = {{Chembox Pharmacology
| AdminRoutes =
| AdminRoutes =
Line 72: Line 85:
| Legal_AU =
| Legal_AU =
| Legal_CA =
| Legal_CA =
| PregCat =
| Pregnancy_category =
| PregCat_AU =
| Pregnancy_AU =
| PregCat_US = }}
| Pregnancy_US =
}}

| Section6 = {{Chembox Explosive
| Section6 = {{Chembox Explosive
| ShockSens =
| ShockSens =
| FrictionSens =
| FrictionSens =
| ExplosiveV =
| DetonationV =
| REFactor = }}
| REFactor =
}}

| Section7 = {{Chembox Hazards
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| ExternalSDS =
| EUClass =
| EUIndex =
| MainHazards =
| MainHazards =
| NFPA-H =
| NFPA-H =
| NFPA-F =
| NFPA-F =
| NFPA-R =
| NFPA-R =
| NFPA-O =
| NFPA-S =
| RPhrases =
| SPhrases = {{S24/25}}
| RSPhrases =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
| ExploLimits =
| ExploLimits =
| PEL = }}
| PEL =
}}

| Section8 = {{Chembox Related
| Section8 = {{Chembox Related
| OtherFunctn = [[N-Acetylglucosamine|''N''-Acetylglucosamine]]<br>[[Galactosamine]]<br>[[Galactose]]
| OtherFunction = [[N-Acetylglucosamine|''N''-Acetylglucosamine]]<br>[[Galactosamine]]<br>[[Galactose]]
| Function = [[monosaccharide]]s
| OtherFunction_label = [[monosaccharide]]s
| OtherCpds = }}
| OtherCompounds =
}}
}}
}}

'''''N''-Acetylgalactosamine''' ('''GalNAc'''), is an [[amino sugar]] derivative of [[galactose]].

==Function==
In humans it is the terminal carbohydrate forming the antigen of [[ABO blood group system|blood group]] A.<ref>{{cite journal |title=Immunochemical Studies on Blood Groups. XXXI. Destruction of Blood Group A Activity by an Enzyme from Clostridium tertium Which Deacetylates N-Acetylgalactosamine in Intact Blood Group Substances |author1=Donald M. Marcus |author2=Elvin A. Kabat |author3=Gerald Schiffman |journal=Biochemistry |year=1964 |volume=3 |issue=3 |pages=437–443 |doi=10.1021/bi00891a023 }}</ref>

It is typically the first monosaccharide that connects [[serine]] or [[threonine]] in particular forms of protein [[Glycosylation|''O''-glycosylation]].

''N''-Acetylgalactosamine is necessary for [[cell signaling|intercellular communication]], and is concentrated in sensory nerve structures of both humans and animals.

GalNAc is also used as a targeting [[Ligand_(biochemistry)|ligand]] in investigational [[Antisense_therapy|antisense oligonucleotides]] and [[siRNA]] therapies targeted to the liver, where it binds to the [[Asialoglycoprotein_receptor|asialoglycoprotein receptors]] on [[hepatocytes]]. <ref>{{Cite journal |doi = 10.1021/ja505986a|pmid = 25434769|title = Multivalent N-Acetylgalactosamine-Conjugated siRNA Localizes in Hepatocytes and Elicits Robust RNAi-Mediated Gene Silencing|journal = Journal of the American Chemical Society|volume = 136|issue = 49|pages = 16958–16961|year = 2014|last1 = Nair|first1 = Jayaprakash K|last2 = Willoughby|first2 = Jennifer L. S|last3 = Chan|first3 = Amy|last4 = Charisse|first4 = Klaus|last5 = Alam|first5 = Md. Rowshon|last6 = Wang|first6 = Qianfan|last7 = Hoekstra|first7 = Menno|last8 = Kandasamy|first8 = Pachamuthu|last9 = Kel'In|first9 = Alexander V|last10 = Milstein|first10 = Stuart|last11 = Taneja|first11 = Nate|last12 = o'Shea|first12 = Jonathan|last13 = Shaikh|first13 = Sarfraz|last14 = Zhang|first14 = Ligang|last15 = Van Der Sluis|first15 = Ronald J|last16 = Jung|first16 = Michael E|last17 = Akinc|first17 = Akin|last18 = Hutabarat|first18 = Renta|last19 = Kuchimanchi|first19 = Satya|last20 = Fitzgerald|first20 = Kevin|last21 = Zimmermann|first21 = Tracy|last22 = Van Berkel|first22 = Theo J. C|last23 = Maier|first23 = Martin A|last24 = Rajeev|first24 = Kallanthottathil G|last25 = Manoharan|first25 = Muthiah|url = http://www.escholarship.org/uc/item/54c114pc}}</ref>

==See also==
* [[Galactosamine]]
* [[Globoside]]
* ([[N-Acetylglucosamine|''N''-Acetylglucosamine]]) GlcNAc

==References==
{{Reflist}}

==External links==
*{{Commonscatinline}}

{{DEFAULTSORT:Acetylgalactosamine, N-}}
[[Category:Acetamides]]
[[Category:Hexosamines]]
[[Category:Membrane biology]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"